CymitQuimica logo

CAS 78140-52-0

:

(3R)-3-(isothiocyanatomethyl)-2,2,5,5-tetramethylpyrrolidin-1-ol

Description:
The chemical substance known as (3R)-3-(isothiocyanatomethyl)-2,2,5,5-tetramethylpyrrolidin-1-ol, with the CAS number 78140-52-0, is a chiral compound featuring a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a hydroxyl group (-OH) and an isothiocyanate group (-N=C=S) attached to the pyrrolidine structure, contributing to its reactivity and potential biological activity. The presence of multiple methyl groups enhances its steric bulk and may influence its solubility and interaction with biological systems. The specific stereochemistry at the 3-position (designated as (3R)) indicates that it has a particular spatial arrangement, which can significantly affect its pharmacological properties and interactions with other molecules. This compound may be of interest in medicinal chemistry and organic synthesis, particularly in the development of novel therapeutic agents or as a reagent in chemical reactions. Its unique structural features make it a subject of study in various fields, including organic chemistry and biochemistry.
Formula:C10H18N2OS
InChI:InChI=1/C10H18N2OS/c1-9(2)5-8(6-11-7-14)10(3,4)12(9)13/h8,13H,5-6H2,1-4H3/t8-/m1/s1
SMILES:CC1(C)C[C@H](CN=C=S)C(C)(C)N1O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.