CymitQuimica logo

CAS 78149-83-4

:

N-(2-chloroethyl)-N-(2-chloropropyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide

Description:
N-(2-chloroethyl)-N-(2-chloropropyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide, with the CAS number 78149-83-4, is a chemical compound that belongs to the class of oxazaphosphorines. This substance is characterized by the presence of a phosphorus atom in its structure, which is typically associated with various biological activities, including potential applications in pharmaceuticals and agrochemicals. The compound features two chloroalkyl substituents, which can enhance its reactivity and influence its interaction with biological systems. The oxazaphosphorine framework contributes to its stability and may impart unique properties such as solubility in organic solvents. Additionally, the presence of the amine and oxide functional groups suggests potential for hydrogen bonding and reactivity with other chemical species. Overall, this compound's unique structural features may lead to diverse applications, although specific biological or chemical activities would require further investigation to fully understand its potential uses and safety profile.
Formula:C8H17Cl2N2O2P
InChI:InChI=1/C8H17Cl2N2O2P/c1-8(10)7-12(5-3-9)15(13)11-4-2-6-14-15/h8H,2-7H2,1H3,(H,11,13)
SMILES:CC(CN(CCCl)P1(=O)NCCCO1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.