CAS 78155-74-5

Methyl 5-bromo-1H-indazole-3-carboxylate

Description:

Methyl 5-bromo-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 5-position of the indazole ring contributes to its reactivity and potential applications in medicinal chemistry. The carboxylate functional group at the 3-position, esterified with a methyl group, enhances its solubility and reactivity, making it useful in various chemical reactions, including esterification and nucleophilic substitutions. This compound is often utilized in the synthesis of biologically active molecules and may exhibit interesting pharmacological properties. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in drug discovery and development. Additionally, the compound's stability and reactivity can be influenced by the presence of the bromine substituent, which can participate in further chemical transformations. Overall, Methyl 5-bromo-1H-indazole-3-carboxylate is a versatile compound with significant implications in organic synthesis and medicinal chemistry.

Formula: C₉H₇BrN₂O₂

InChI: InChI=1/C9H7BrN2O2/c1-14-9(13)8-6-4-5(10)2-3-7(6)11-12-8/h2-4H,1H3,(H,11,12)

SMILES: COC(=O)c1c2cc(ccc2[nH]n1)Br

Synonyms:

• 1H-indazole-3-carboxylic acid, 5-bromo-, methyl ester
• Methyl-5-brom-1H-indazol-3-carboxylat

Methyl 5-Bromo-1H-indazole-3-carboxylate

CAS: 78155-74-5

Formula: C₉H₇BrN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 255.0681

Ref: IN-DA00357U

Methyl 5-bromo-1H-indazole-3-carboxylate

CAS: 78155-74-5

Methyl 5-bromo-1H-indazole-3-carboxylate

Formula: C₉H₇BrN₂O₂

Purity: 97%

Color and Shape: white to off-white solid

Molecular weight: 255.07g/mol

Ref: 54-OR62000

Methyl 5-bromo-1H-indazole-3-carboxylate

CAS: 78155-74-5

Formula: C₉H₇BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 255.071

Ref: 10-F236657