CAS 78156-04-4
:N1-[2-(4-Morpholinyl)ethyl]-1,2-benzenediamine
Description:
N1-[2-(4-Morpholinyl)ethyl]-1,2-benzenediamine, with the CAS number 78156-04-4, is an organic compound characterized by its structure, which includes a benzene ring substituted with two amino groups and a morpholine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the morpholine ring contributes to its potential as a pharmacophore in medicinal chemistry, often enhancing biological activity and selectivity. It may also display moderate lipophilicity due to the aromatic and aliphatic components of its structure. The compound's reactivity can be attributed to the amino groups, which can participate in various chemical reactions, including acylation and alkylation. Additionally, its potential applications may span across fields such as drug development, where it could serve as a lead compound or a building block for synthesizing more complex molecules. Safety and handling precautions should be observed, as with many amine-containing compounds, due to potential toxicity and reactivity.
Formula:C12H19N3O
InChI:InChI=1S/C12H19N3O/c13-11-3-1-2-4-12(11)14-5-6-15-7-9-16-10-8-15/h1-4,14H,5-10,13H2
InChI key:InChIKey=VUNFYZZNGWQFHN-UHFFFAOYSA-N
SMILES:N(CCN1CCOCC1)C2=C(N)C=CC=C2
Synonyms:- N1-[2-(4-Morpholinyl)ethyl]-1,2-benzenediamine
- 1,2-Benzenediamine, N1-[2-(4-morpholinyl)ethyl]-
- 2-(2-Morpholinoethylamino)aniline
- 1,2-Benzenediamine N1-[2-(4-morpholinyl)ethyl]-
- 1,2-Benzenediamine, N-[2-(4-morpholinyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.