CAS 78156-40-8
:3-Pyridinamine, 5-methoxy-, 1-oxide
Description:
3-Pyridinamine, 5-methoxy-, 1-oxide, with the CAS number 78156-40-8, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the methoxy group at the 5-position indicates that there is a methoxy (-OCH3) substituent attached to the ring, which can influence the compound's reactivity and solubility. The "1-oxide" designation suggests that there is an oxidation state change at the nitrogen atom, typically indicating the presence of a nitrogen-oxide functional group. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its properties, such as solubility, stability, and reactivity, can be influenced by the functional groups present and the overall molecular structure. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other interactions, which can affect its behavior in different chemical environments.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-10-6-2-5(7)3-8(9)4-6/h2-4H,7H2,1H3
InChI key:InChIKey=FRBFPGNUTPJOHJ-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(N)C=N(=O)C1
Synonyms:- 3-Amino-5-methoxypyridine 1-oxide
- 3-Amino-5-methoxypyridin-1-ium-1-olate
- 3-Pyridinamine, 5-methoxy-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.