CAS 781599-92-6
:5-(chloromethyl)-1-isobutyl-imidazole
Description:
5-(Chloromethyl)-1-isobutyl-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a chloromethyl group at the 5-position and an isobutyl group at the 1-position contributes to its unique reactivity and solubility properties. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the functional groups attached to the imidazole ring. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in organic synthesis and medicinal chemistry. The chloromethyl group can serve as a reactive site for further functionalization, while the isobutyl group may influence the compound's lipophilicity and biological activity. Safety data should be consulted, as halogenated compounds can pose health risks. Overall, 5-(chloromethyl)-1-isobutyl-imidazole is of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C8H13ClN2
InChI:InChI=1/C8H13ClN2/c1-7(2)5-11-6-10-4-8(11)3-9/h4,6-7H,3,5H2,1-2H3
SMILES:CC(C)Cn1cncc1CCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.