CymitQuimica logo

CAS 781612-89-3

:

2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine

Description:
2,4-Dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine is a heterocyclic compound characterized by its complex ring structure, which includes both pyrimidine and azepine moieties. This compound features two chlorine atoms at the 2 and 4 positions, contributing to its reactivity and potential biological activity. The tetrahydro configuration indicates that the compound contains saturated carbon atoms within its ring system, which can influence its physical properties, such as solubility and stability. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The presence of multiple functional groups and halogens can also affect the compound's interactions with biological targets, potentially leading to varied therapeutic effects. Additionally, the molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. Overall, 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine represents a unique chemical entity with potential applications in drug development and research.
Formula:C8H9Cl2N3
InChI:InChI=1/C8H9Cl2N3/c9-7-5-1-3-11-4-2-6(5)12-8(10)13-7/h11H,1-4H2
Synonyms:
  • 2,4-Dichloro-6,7,8,9-tetrahydro-5H-pyrimido[5,4-d]azepine
  • 5H-pyrimido[4,5-d]azepine, 2,4-dichloro-6,7,8,9-tetrahydro-
  • 2,4-dichloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine
  • tert-Butyl 2,4-dichloro-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.