CAS 78162-04-6

1-[2-(Z)-Methoxyimino-2-(2-Aminothiazol-4-YL) Acetyl] Benzo-trizole-3-oxide

Description:

1-[2-(Z)-Methoxyimino-2-(2-Aminothiazol-4-YL) Acetyl] Benzo-trizole-3-oxide, with CAS number 78162-04-6, is a chemical compound that exhibits a complex structure featuring a triazole ring, which is known for its diverse biological activities. The presence of the methoxyimino and aminothiazole groups suggests potential applications in medicinal chemistry, particularly in the development of antimicrobial or antifungal agents. The compound's structure indicates that it may engage in hydrogen bonding and other intermolecular interactions, which can influence its solubility and reactivity. Additionally, the presence of functional groups such as the methoxyimino and acetyl moieties may enhance its pharmacological properties. As with many compounds containing heterocycles, it may exhibit unique electronic properties that could be exploited in various chemical reactions or applications. Overall, this compound represents a class of molecules that could be of interest in drug discovery and development, particularly in targeting specific biological pathways.

Formula: C₁₂H₁₀N₆O₃S

InChI: InChI=1/C12H10N6O3S/c1-21-15-10(7-6-22-12(13)14-7)11(19)17-8-4-2-3-5-9(8)18(20)16-17/h2-6H,1H3,(H2,13,14)/b15-10-

SMILES: CO/N=C(/c1csc(=N)[nH]1)\C(=O)n1c2ccccc2n(=O)n1

Synonyms:

• 1-[2-(Z)-Methoxyimino-2-(2-Aminothiazol-4-Yl)Acetyl]Benzotrizole-3-Oxide
• (2Z)-2-(2-aminothiazol-4-yl)-2-methoxyimino-1-(3-oxidobenzotriazol-3-ium-1-yl)ethanone