CAS 781626-61-7

N-[4-[(Dimethylamino)sulfonyl]benzoyl]glycine

Description:

N-[4-[(Dimethylamino)sulfonyl]benzoyl]glycine, with the CAS number 781626-61-7, is a chemical compound that belongs to the class of sulfonamides. It features a glycine moiety linked to a benzoyl group, which is further substituted with a dimethylaminosulfonyl group. This structure imparts unique properties, including potential biological activity, making it of interest in pharmaceutical research. The compound is typically characterized by its solubility in polar solvents, which is influenced by the presence of the sulfonyl and amino groups. Its molecular structure suggests it may participate in hydrogen bonding, enhancing its interactions in biological systems. Additionally, the dimethylamino group can contribute to its basicity, affecting its reactivity and interaction with other molecules. Overall, N-[4-[(Dimethylamino)sulfonyl]benzoyl]glycine is a compound of interest for its potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₁H₁₄N₂O₅S

InChI: InChI=1S/C11H14N2O5S/c1-13(2)19(17,18)9-5-3-8(4-6-9)11(16)12-7-10(14)15/h3-6H,7H2,1-2H3,(H,12,16)(H,14,15)

InChI key: InChIKey=FXMOABSIRKWMHY-UHFFFAOYSA-N

SMILES: S(N(C)C)(=O)(=O)C1=CC=C(C(NCC(O)=O)=O)C=C1

Synonyms:

• N-[4-[(Dimethylamino)sulfonyl]benzoyl]glycine
• Glycine, N-[4-[(dimethylamino)sulfonyl]benzoyl]-