CAS 781658-23-9
:4-Hydroxyisoleucine
Description:
4-Hydroxyisoleucine is a naturally occurring amino acid derivative, specifically a non-proteinogenic amino acid, that is primarily found in the seeds of the legume Mucuna pruriens. It is recognized for its potential role in enhancing insulin sensitivity and promoting glucose uptake in muscle cells, making it of interest in metabolic research and potential therapeutic applications for conditions like diabetes. The compound features a hydroxyl group (-OH) at the fourth carbon of the isoleucine structure, which contributes to its unique biochemical properties. 4-Hydroxyisoleucine is typically studied for its effects on lipid metabolism and its ability to influence the secretion of insulin from pancreatic beta cells. In terms of physical properties, it is generally a white to off-white crystalline powder, soluble in water, and stable under standard conditions. Its safety profile and efficacy in humans are still under investigation, highlighting the need for further research to fully understand its biological effects and potential applications in health and nutrition.
Formula:C6H13NO3
InChI:InChI=1/C6H13NO3/c1-3(4(2)8)5(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10)
SMILES:CC(C(C)O)C(C(=O)O)N
Synonyms:- 4-Hydroxy-L-isoleucine
- 2-Amino-4-Hydroxy-3-Methylpentanoic Acid (Non-Preferred Name)
- (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid
- L-erythro-Pentonic acid, 2-amino-2,3,5-trideoxy-3-methyl-, (4ξ)-
- L-4-Hydroxyisoleucine
- (4S)-4-Hydroxy-L-isoleucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
4-Hydroxyisoleucine
CAS:Non-aromatic amino-compounds with oxygen functionFormula:C6H13NO3Color and Shape:White CrystalsMolecular weight:147.089544-Hydroxyisoleucine
CAS:Purity:≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:147.13(4S)-4-Hydroxy-L-isoleucine from fenugre
CAS:<p>(4S)-4-Hydroxy-L-isoleucine from fenugre</p>Purity:97%Color and Shape:White PowderMolecular weight:147.17g/mol4-Hydroxyisoleucine
CAS:<p>4-Hydroxyisoleucine (4-Hydroxy-L-isoleucine) has antidepressant-like, antidyslipidemic, and antihyperglycemic effects. It displays an insulinotropic activity.</p>Formula:C6H13NO3Purity:99.83%Color and Shape:SolidMolecular weight:147.174-hydroxy l-isoleucine
CAS:Amino acidFormula:C6H13NO3Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:147.174-Hydroxy-L-isoleucine
CAS:<p>Insulinotropic; anti-diabetic</p>Formula:C6H13NO3Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:147.17 g/mol
