
CAS 781676-74-2
:Dihydro-3-(2-methoxyphenyl)-2,5-furandione
Description:
Dihydro-3-(2-methoxyphenyl)-2,5-furandione, with the CAS number 781676-74-2, is a chemical compound characterized by its unique structure that includes a furan ring and a methoxyphenyl group. This compound typically exhibits properties associated with both furan derivatives and aromatic compounds, such as potential reactivity due to the presence of the furan moiety, which can participate in various chemical reactions, including electrophilic substitutions and cycloadditions. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. Dihydro-3-(2-methoxyphenyl)-2,5-furandione may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its stability, melting point, and solubility characteristics would depend on the specific conditions and purity of the compound. Overall, this substance represents a class of compounds that could have applications in drug development and materials science, although specific biological or industrial applications would require further investigation.
Formula:C11H10O4
InChI:InChI=1S/C11H10O4/c1-14-9-5-3-2-4-7(9)8-6-10(12)15-11(8)13/h2-5,8H,6H2,1H3
InChI key:InChIKey=HQXQWVOJQNRHTM-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C2CC(=O)OC2=O
Synonyms:- Dihydro-3-(2-methoxyphenyl)-2,5-furandione
- (2-Methoxy-phenyl)-succinic acid-anhydride
- 2,5-Furandione, dihydro-3-(2-methoxyphenyl)-
- Succinic anhydride, (o-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.