CAS 78173-95-2

5-Carboxymethylaminomethyl-2-thiouridine

Description:

5-Carboxymethylaminomethyl-2-thiouridine is a modified nucleoside that features a thiouridine base, which is a sulfur-containing analog of uridine. This compound is characterized by the presence of a carboxymethylaminomethyl group at the 5-position of the ribose sugar, which contributes to its unique chemical properties and biological functions. The thiol group in the thiouridine structure can participate in various biochemical reactions, potentially influencing the stability and reactivity of RNA molecules. This modification can affect the nucleoside's interactions with enzymes and other biomolecules, making it of interest in studies related to RNA biology and therapeutics. Additionally, the presence of the carboxymethyl group may enhance solubility and alter the compound's overall polarity. Such modifications are often explored for their potential roles in enhancing the efficacy of nucleoside analogs in antiviral and anticancer therapies. Overall, 5-Carboxymethylaminomethyl-2-thiouridine represents a significant area of research in the field of medicinal chemistry and molecular biology.

Formula: C₁₂H₁₇N₃O₇S

InChI: InChI=1S/C12H17N3O7S/c16-4-6-8(19)9(20)11(22-6)15-3-5(1-13-2-7(17)18)10(21)14-12(15)23/h3,6,8-9,11,13,16,19-20H,1-2,4H2,(H,17,18)(H,14,21,23)/t6-,8-,9-,11-/m1/s1

InChI key: InChIKey=VKLFQTYNHLDMDP-PNHWDRBUSA-N

SMILES: O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C=C(CNCC(O)=O)C(=O)NC2=S

Synonyms:

• N-[(1,2,3,4-Tetrahydro-4-oxo-1-β-D-ribofuranosyl-2-thioxo-5-pyrimidinyl)methyl]glycine
• 5-Carboxymethylaminomethyl-2-thiouridine
• Glycine, N-[(1,2,3,4-tetrahydro-4-oxo-1-β-D-ribofuranosyl-2-thioxo-5-pyrimidinyl)methyl]-

5-Carboxymethylaminomethyl-2-thiouridine

Controlled Product

CAS: 78173-95-2

Formula: C₁₂H₁₇N₃O₇S

Color and Shape: Neat

Molecular weight: 347.344

Ref: TR-C175978