CAS 78177-12-5

6-(propan-2-yl)pyridin-2-amine

Description:

6-(Propan-2-yl)pyridin-2-amine, also known by its CAS number 78177-12-5, is an organic compound characterized by a pyridine ring substituted with an amino group and an isopropyl group. The presence of the amino group (-NH2) at the 2-position of the pyridine ring contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions. The isopropyl group at the 6-position provides steric hindrance, which can influence the compound's reactivity and interactions with other molecules. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and specific reactivity, would depend on its purity and the conditions under which it is handled.

Formula: C₈H₁₂N₂

InChI: InChI=1/C8H12N2/c1-6(2)7-4-3-5-8(9)10-7/h3-6H,1-2H3,(H2,9,10)

SMILES: CC(C)c1cccc(N)n1

Synonyms:

• 2-Pyridinamine, 6-(1-methylethyl)-
• 6-Isopropylpyridin-2-amine

6-isopropylpyridin-2-amine

CAS: 78177-12-5

Formula: C₈H₁₂N₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 136.1943

Ref: IN-DA003GIK

6-Isopropylpyridin-2-amine

CAS: 78177-12-5

6-Isopropylpyridin-2-amine

Purity: 98%

Molecular weight: 136.19g/mol

Ref: 54-OR951694

6-Isopropylpyridin-2-amine

CAS: 78177-12-5

Formula: C₈H₁₂N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 136.198

Ref: 10-F079560