CAS 78180-89-9
:2-Pyridinepropanamine, γ-(4-chlorophenyl)-N,N-dimethyl-, 1-oxide
Description:
2-Pyridinepropanamine, γ-(4-chlorophenyl)-N,N-dimethyl-, 1-oxide, with the CAS number 78180-89-9, is a chemical compound that features a pyridine ring and a propanamine structure, characterized by the presence of a dimethylamino group and a 4-chlorophenyl substituent. This compound is typically classified as a tertiary amine due to the presence of the dimethylamino group, which contributes to its basicity and potential reactivity. The 1-oxide designation indicates the presence of an oxygen atom bonded to the nitrogen, which can influence the compound's electronic properties and reactivity. In terms of physical properties, such compounds often exhibit moderate solubility in polar solvents due to the presence of both hydrophobic aromatic and hydrophilic amine functionalities. The chlorophenyl group may impart additional biological activity or influence the compound's interaction with biological systems. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific applications would depend on further research and characterization.
Formula:C16H19ClN2O
InChI:InChI=1S/C16H19ClN2O/c1-18(2)12-10-15(13-6-8-14(17)9-7-13)16-5-3-4-11-19(16)20/h3-9,11,15H,10,12H2,1-2H3
InChI key:InChIKey=QNZURNFAGZBQSO-UHFFFAOYSA-N
SMILES:C(CCN(C)C)(C=1N(=O)=CC=CC1)C2=CC=C(Cl)C=C2
Synonyms:- Pyridine, 2-[p-chloro-α-[2-(dimethylamino)ethyl]benzyl]-, 1-oxide
- Chlorpheniramine-N-oxide
- 2-Pyridinepropanamine, γ-(4-chlorophenyl)-N,N-dimethyl-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
