CAS 78182-92-0
:(3E)-3-(cyclohexylimino)-N,5-diphenyl-3,5-dihydrophenazin-2-amine
Description:
The chemical substance known as (3E)-3-(cyclohexylimino)-N,5-diphenyl-3,5-dihydrophenazin-2-amine, with the CAS number 78182-92-0, is a complex organic compound characterized by its unique structural features. It contains a phenazin core, which is a bicyclic structure known for its potential biological activity. The presence of the cyclohexylimino group introduces a degree of steric hindrance and may influence the compound's reactivity and solubility. The diphenyl substituents enhance the compound's aromatic character, potentially affecting its electronic properties and interactions with other molecules. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its stability, solubility, and reactivity would be influenced by the functional groups present. Overall, this compound represents a class of nitrogen-containing heterocycles that are often explored for their applications in various fields, including pharmaceuticals and materials science.
Formula:C30H28N4
InChI:InChI=1/C30H28N4/c1-4-12-22(13-5-1)31-26-20-28-30(21-27(26)32-23-14-6-2-7-15-23)34(24-16-8-3-9-17-24)29-19-11-10-18-25(29)33-28/h1,3-5,8-13,16-21,23,31H,2,6-7,14-15H2/b32-27+
Synonyms:- 2-Phenazinamine, 3-(cyclohexylimino)-3,5-dihydro-N,5-diphenyl-
- 2-phenazinamine, 3-(cyclohexylimino)-3,5-dihydro-N,5-diphenyl-, (3E)-
- 3-(Cyclohexylimino)-3,5-dihydro-N,5-diphenyl-2-phenazinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
B 669
CAS:B 669 has antibacterial activity.Formula:C30H28N4Color and Shape:SolidMolecular weight:444.57

