CAS 78182-93-1
:N'-[(2E)-10-(4-chlorophenyl)-3-[(4-chlorophenyl)amino]phenazin-2(10H)-ylidene]-N,N-diethylethane-1,2-diamine
Description:
The chemical substance N'-[(2E)-10-(4-chlorophenyl)-3-[(4-chlorophenyl)amino]phenazin-2(10H)-ylidene]-N,N-diethylethane-1,2-diamine, with CAS number 78182-93-1, is characterized by its complex molecular structure, which includes a phenazine core substituted with multiple aromatic groups and a diethylamine moiety. This compound exhibits properties typical of organic dyes or pigments, often displaying significant color and potential applications in biological systems due to its ability to interact with various biomolecules. The presence of chlorophenyl groups suggests potential for enhanced lipophilicity and biological activity, possibly influencing its pharmacological properties. Additionally, the amine functionalities may participate in hydrogen bonding and coordination with metal ions, which could be relevant in catalysis or as a ligand in coordination chemistry. Overall, this compound's unique structure and substituents contribute to its potential utility in fields such as medicinal chemistry, materials science, and dye technology.
Formula:C30H29Cl2N5
InChI:InChI=1/C30H29Cl2N5/c1-3-36(4-2)18-17-33-26-20-30-28(19-27(26)34-23-13-9-21(31)10-14-23)35-25-7-5-6-8-29(25)37(30)24-15-11-22(32)12-16-24/h5-16,19-20,34H,3-4,17-18H2,1-2H3/b33-26+
Synonyms:- 1,2-Ethanediamine, N'-(10-(4-chlorophenyl)-3-((4-chlorophenyl)amino)-2(10H)-phenazinylidene)-N,N-diethyl-
- 1,2-ethanediamine, N~2~-[(2E)-10-(4-chlorophenyl)-3-[(4-chlorophenyl)amino]-2(10H)-phenazinylidene]-N~1~,N~1~-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
