CAS 78184-43-7
:L-Allonic acid, γ-lactone
Description:
L-Allonic acid, γ-lactone, is a chemical compound characterized by its lactone structure, which is a cyclic ester formed from the condensation of an alcohol and a carboxylic acid. This compound is derived from L-allonic acid, a naturally occurring sugar acid. It typically exhibits properties such as being a white to off-white solid, with potential solubility in polar solvents due to the presence of hydroxyl groups. The lactone form suggests it may have a stable ring structure, which can influence its reactivity and interactions with other molecules. L-Allonic acid, γ-lactone may have applications in biochemistry and pharmaceuticals, particularly in the study of metabolic pathways and as a potential precursor in the synthesis of other organic compounds. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the conditions under which it is studied. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C6H10O6
InChI:InChI=1S/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2/t2-,3+,4-,5-/m0/s1
InChI key:InChIKey=SXZYCXMUPBBULW-QTBDOELSSA-N
SMILES:[C@@H](CO)(O)[C@]1([C@H](O)[C@H](O)C(=O)O1)[H]
Synonyms:- L-Allonic acid, γ-lactone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
L-Allono-1,4-lactone
CAS:<p>L-Allono-1,4-lactone is a molecule with a stereocenter. It has been shown to be a target molecule for glycosidase inhibitors. The inhibition of the enzyme by L-allono-1,4-lactone may be due to its ability to form a hydrogen bond with the oxygen atom in the active site of the enzyme and its hydroxyl group that can form an additional hydrogen bond with water molecules. This inhibition prevents the transfer of glucose from one substrate to another, which leads to inefficient glycosidase activity. The synthesis of L-allono-1,4-lactone has been studied using piperidine as a starting material.</p>Formula:C6H10O6Purity:Min. 95%Color and Shape:PowderMolecular weight:178.14 g/mol
