CymitQuimica logo

CAS 78188-38-2

:

[(3aR,4R,6R,6aR)-4-[6-(benzylamino)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol

Description:
The chemical substance with the name "[(3aR,4R,6R,6aR)-4-[6-(benzylamino)purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol" and CAS number 78188-38-2 is a complex organic compound characterized by its multi-ring structure and functional groups. It features a purine moiety, which is significant in biochemistry, particularly in nucleic acids. The presence of a benzylamino group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The tetrahydrofurodioxole framework contributes to its structural rigidity and may influence its solubility and reactivity. Additionally, the methanol group indicates the presence of a hydroxyl functional group, which can participate in hydrogen bonding, enhancing its potential biological activity. Overall, this compound's intricate structure and functional groups suggest it may exhibit unique pharmacological properties, warranting further investigation in drug development and therapeutic applications.
Formula:C20H23N5O4
InChI:InChI=1/C20H23N5O4/c1-20(2)28-15-13(9-26)27-19(16(15)29-20)25-11-24-14-17(22-10-23-18(14)25)21-8-12-6-4-3-5-7-12/h3-7,10-11,13,15-16,19,26H,8-9H2,1-2H3,(H,21,22,23)/t13-,15-,16-,19-/m1/s1
SMILES:CC1(C)O[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O1)n1cnc2c(NCc3ccccc3)ncnc12
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.