CAS 78189-50-1

5-phenylisoxazole-3-carbonyl chloride

Description:

5-Phenylisoxazole-3-carbonyl chloride is an organic compound characterized by its isoxazole ring structure, which features a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. The presence of a phenyl group enhances its aromatic properties, contributing to its stability and reactivity. As a carbonyl chloride, it contains a carbonyl group (C=O) adjacent to a chlorine atom, making it a reactive acyl chloride. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, due to its ability to participate in acylation reactions. Its reactivity allows it to form amides, esters, and other derivatives when reacted with nucleophiles. The compound is generally handled with care due to its potential to release hydrochloric acid upon hydrolysis, which can be corrosive. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety precautions during handling and use in laboratory settings. Overall, 5-phenylisoxazole-3-carbonyl chloride is a valuable intermediate in synthetic organic chemistry.

Formula: C₁₀H₆ClNO₂

InChI: InChI=1/C10H6ClNO2/c11-10(13)8-6-9(14-12-8)7-4-2-1-3-5-7/h1-6H

SMILES: c1ccc(cc1)c1cc(C(=O)Cl)no1

5-Phenylisoxazole-3-carbonyl chloride

CAS: 78189-50-1

Formula: C₁₀H₆ClNO₂

Color and Shape: Solid

Molecular weight: 207.6131

Ref: IN-DA0054PF

5-Phenyl-isoxazole-3-carbonyl chloride

CAS: 78189-50-1

5-Phenyl-isoxazole-3-carbonyl chloride

Purity: 95%

Molecular weight: 207.61g/mol

Ref: 54-OR346228

5-Phenyl-isoxazole-3-carbonyl chloride

CAS: 78189-50-1

Formula: C₁₀H₆ClNO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 207.61

Ref: 10-F317190

5-Phenyl-isoxazole-3-carbonyl chloride

CAS: 78189-50-1

5-Phenyl-isoxazole-3-carbonyl chloride is a cytostatic drug that inhibits the activity of tyrosine kinases. It binds to amines and furyl groups in proteins and prevents the formation of ATP. This leads to cell death by blocking the synthesis of DNA, RNA, and protein. 5-Phenyl-isoxazole-3-carbonyl chloride has been shown to be effective against primary tumors and medulloblastoma cells. It is also used as a ligand for metals such as platinum or cisplatin, which can be used for cancer treatments.

Formula: C₁₀H₆ClNO₂

Purity: Min. 95%

Molecular weight: 207.61 g/mol

Ref: 3D-DDA18950