CymitQuimica logo

CAS 78194-29-3

:

2-chloro-N-(ethoxymethyl)-N-[2-methyl-6-(trifluoromethyl)phenyl]acetamide

Description:
2-Chloro-N-(ethoxymethyl)-N-[2-methyl-6-(trifluoromethyl)phenyl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro group, an ethoxymethyl substituent, and a phenyl ring with a trifluoromethyl group. This compound is typically classified as an acetamide due to the presence of the acetamide functional group. The presence of the chloro substituent suggests potential reactivity, while the trifluoromethyl group can enhance lipophilicity and influence biological activity. The ethoxymethyl group may contribute to the compound's solubility and stability. This compound is of interest in medicinal chemistry and may exhibit specific pharmacological properties, making it a candidate for further research in drug development. Its unique combination of functional groups can lead to diverse interactions in biological systems, potentially affecting its efficacy and safety profile. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols due to potential toxicity or reactivity.
Formula:C13H15ClF3NO2
InChI:InChI=1/C13H15ClF3NO2/c1-3-20-8-18(11(19)7-14)12-9(2)5-4-6-10(12)13(15,16)17/h4-6H,3,7-8H2,1-2H3
SMILES:CCOCN(C(=O)CCl)c1c(C)cccc1C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.