CAS 78197-28-1

4-(Cyclohexylmethyl)piperidine

Description:

4-(Cyclohexylmethyl)piperidine, identified by its CAS number 78197-28-1, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a cyclohexylmethyl substituent at the 4-position of the piperidine ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. This substance is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. Its molecular structure allows for flexibility and potential lipophilicity, which can influence its pharmacokinetic properties. Additionally, 4-(Cyclohexylmethyl)piperidine may exhibit basic properties due to the presence of the nitrogen atom in the piperidine ring, allowing it to participate in protonation and other chemical reactions. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential health risks associated with exposure.

Formula: C₁₂H₂₃N

InChI: InChI=1S/C12H23N/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h11-13H,1-10H2

InChI key: InChIKey=ZDYLEXHUSVXJPP-UHFFFAOYSA-N

SMILES: C(C1CCCCC1)C2CCNCC2

Synonyms:

• Piperidine, 4-(cyclohexylmethyl)-
• 4-Cyclohexylmethylpiperidine
• NSC 173078
• 4-(Cyclohexylmethyl)piperidine