CAS 782-17-2
:2-(4-Fluorophenyl)indole
Description:
2-(4-Fluorophenyl)indole, with the CAS number 782-17-2, is an organic compound that features a fused indole structure substituted with a fluorophenyl group. This compound typically exhibits a white to off-white crystalline appearance. It is characterized by its aromatic properties, which arise from both the indole and the fluorophenyl moieties, contributing to its potential applications in medicinal chemistry and material science. The presence of the fluorine atom enhances the compound's lipophilicity and can influence its biological activity, making it of interest in drug development. Additionally, 2-(4-Fluorophenyl)indole may exhibit interesting photophysical properties, which can be useful in various applications, including fluorescence-based assays. Its solubility can vary depending on the solvent, and it is generally stable under standard laboratory conditions. As with many indole derivatives, it may also participate in various chemical reactions, including electrophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis.
Formula:C14H10FN
InChI:InChI=1/C14H10FN/c15-13-5-3-10(4-6-13)12-2-1-11-7-8-16-14(11)9-12/h1-9,16H
SMILES:c1cc(cc2c1cc[nH]2)c1ccc(cc1)F
Synonyms:- 2-(Naphth-2-Yl)-1H-Indole
- 2-(4-fluorophenyl)-1H-indole
- 6-(4-fluorophenyl)-1H-indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(4-Fluorophenyl)indole, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H10FNPurity:99%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:211.242-(4-Fluorophenyl)-1H-indole
CAS:Formula:C14H10FNPurity:98%Color and Shape:SolidMolecular weight:211.23432-(4-Fluorophenyl)indole
CAS:2-(4-Fluorophenyl)indoleFormula:C14H10FNPurity:97%Color and Shape: faint brown to light grey solidMolecular weight:211.23g/mol2-(4-Fluorophenyl)indole
CAS:Formula:C14H10FNPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:211.24





