CAS 782-76-3

2-(((4-methylphenyl)imino)methyl)phenol

Description:

2-(((4-methylphenyl)imino)methyl)phenol, also known by its CAS number 782-76-3, is an organic compound characterized by the presence of both imine and phenolic functional groups. This compound features a central phenol moiety substituted with an imine group, which is further connected to a para-methylphenyl group. The presence of the methyl group enhances its hydrophobic character and can influence its solubility and reactivity. Typically, compounds of this nature exhibit properties such as potential antioxidant activity, and they may participate in various chemical reactions, including condensation and complexation with metal ions. The compound's structure suggests it may have applications in fields such as materials science, organic synthesis, and possibly in biological systems due to its phenolic nature. Its stability, reactivity, and potential biological activity would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents. Safety data should be consulted for handling and usage guidelines.

Formula: C₁₄H₁₃NO

InChI: InChI=1/C14H13NO/c1-11-6-8-13(9-7-11)15-10-12-4-2-3-5-14(12)16/h2-10,15H,1H3

Synonyms:

• 6-{[(4-methylphenyl)amino]methylidene}cyclohexa-2,4-dien-1-one
• N-Salicylidene-p-toluidine
• 2-{[(4-methylphenyl)imino]methyl}phenol