CymitQuimica logo

CAS 78210-43-2

:

3-(3-pyridylmethyl)pyridine

Description:
3-(3-Pyridylmethyl)pyridine, with the CAS number 78210-43-2, is an organic compound characterized by its pyridine rings and a methylene bridge connecting them. This compound features a central pyridine moiety substituted with a 3-pyridylmethyl group, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of nitrogen atoms in the pyridine rings imparts basicity and potential coordination properties, making it of interest in coordination chemistry and as a ligand in metal complexes. Additionally, its structure allows for various intermolecular interactions, such as hydrogen bonding, which can influence its solubility and reactivity. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific reactivity and interactions can vary based on the surrounding environment and the presence of other functional groups.
Formula:C11H10N2
InChI:InChI=1/C11H10N2/c1-3-10(8-12-5-1)7-11-4-2-6-13-9-11/h1-6,8-9H,7H2
Synonyms:
  • 3,3'-Methylenedipyridine
  • pyridine, 3,3'-methylenebis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.