CAS 78210-44-3
:3-(4-Pyridinylmethyl)pyridine
Description:
3-(4-Pyridinylmethyl)pyridine, also known by its CAS number 78210-44-3, is an organic compound characterized by its pyridine ring structure. This compound features a pyridine moiety substituted with a 4-pyridinylmethyl group at the 3-position, which contributes to its unique chemical properties. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. The presence of nitrogen atoms in the pyridine rings imparts basicity and potential for coordination with metal ions, making it of interest in coordination chemistry and catalysis. Additionally, this compound may exhibit biological activity, which could be relevant in medicinal chemistry and drug development. Its solubility in polar solvents, such as water and alcohols, is notable, while its stability under standard conditions allows for various applications in organic synthesis and material science. Overall, 3-(4-Pyridinylmethyl)pyridine is a versatile compound with potential uses in various chemical and pharmaceutical contexts.
Formula:C11H10N2
InChI:InChI=1S/C11H10N2/c1-2-11(9-13-5-1)8-10-3-6-12-7-4-10/h1-7,9H,8H2
InChI key:InChIKey=IKDIAZGTSAFPPL-UHFFFAOYSA-N
SMILES:C(C=1C=CN=CC1)C=2C=CC=NC2
Synonyms:- Pyridine, 3-(4-pyridinylmethyl)-
- 3-(4-Pyridinylmethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
