CAS 78210-66-9
:1-(2-methyl-1H-imidazol-4-yl)ethanone
Description:
1-(2-Methyl-1H-imidazol-4-yl)ethanone, with the CAS number 78210-66-9, is an organic compound characterized by its imidazole ring structure, which contributes to its unique chemical properties. This compound features a ketone functional group, specifically an ethanone moiety, attached to the imidazole ring. The presence of the methyl group at the 2-position of the imidazole enhances its lipophilicity and may influence its biological activity. Typically, compounds like this can exhibit a range of properties, including solubility in polar solvents due to the nitrogen atoms in the imidazole ring, which can engage in hydrogen bonding. Additionally, the compound may possess potential applications in pharmaceuticals or as a building block in organic synthesis due to the reactivity of the ketone group. Its stability, reactivity, and potential interactions with biological systems make it a subject of interest in medicinal chemistry and material science. However, specific physical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c1-4(9)6-3-7-5(2)8-6/h3H,1-2H3,(H,7,8)
Synonyms:- ethanone, 1-(2-methyl-1H-imidazol-4-yl)-
- 1-(2-Methyl-1H-imidazol-4-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
