CymitQuimica logo

CAS 78213-05-5

:

2-Imino-1,3-benzoxathiol-5-ol

Description:
2-Imino-1,3-benzoxathiol-5-ol, with the CAS number 78213-05-5, is a heterocyclic compound characterized by the presence of both an imino group and a benzoxathiol moiety. This compound features a benzene ring fused to a thiol and an imine functional group, contributing to its unique chemical properties. It is typically recognized for its potential biological activity, which may include antimicrobial or antioxidant properties, although specific applications can vary. The presence of sulfur in its structure often enhances its reactivity and interaction with various biological systems. Additionally, the compound may exhibit solubility in polar solvents, which is common for similar heterocyclic compounds. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, safety precautions should be observed when handling it, and its use should be guided by relevant safety data sheets and regulatory guidelines. Further research may be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C7H5NO2S
InChI:InChI=1S/C7H5NO2S/c8-7-10-5-2-1-4(9)3-6(5)11-7/h1-3,8-9H
InChI key:InChIKey=GXZZXIMTXDKQBZ-UHFFFAOYSA-N
SMILES:N=C1OC=2C(S1)=CC(O)=CC2
Synonyms:
  • 2-Imino-1,3-benzoxathiol-5-ol
  • 1,3-Benzoxathiol-5-ol, 2-imino-
  • 2-Imino-benzo[1,3]oxathiol-5-ol
  • 2-Imino-2H-1,3-benzoxathiol-5-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.