CAS 78213-54-4
:glysperin C
Description:
Glysperin C, identified by its CAS number 78213-54-4, is a chemical compound that belongs to the class of glycerol derivatives. It is characterized by its structure, which typically includes a glycerol backbone modified with specific functional groups that enhance its solubility and reactivity. This compound is often utilized in various applications, including pharmaceuticals and cosmetics, due to its potential moisturizing and emulsifying properties. Glysperin C may exhibit low toxicity and is generally considered safe for use in topical formulations. Its hydrophilic nature allows it to interact well with water, making it an effective ingredient in formulations aimed at improving skin hydration. Additionally, it may possess antioxidant properties, contributing to its efficacy in protecting skin from oxidative stress. As with many chemical substances, the specific characteristics, such as melting point, boiling point, and solubility, can vary based on the purity and formulation of the compound. Always refer to safety data sheets and relevant literature for detailed information regarding handling and usage.
Formula:C44H77N7O19
InChI:InChI=1/C44H77N7O19/c1-21(46)39(61)51-29-31(56)28(47)22(2)63-41(29)68-36-26(19-53)66-42(33(58)32(36)57)70-38-30(55)25(18-52)65-44(35(38)60)69-37-27(20-54)67-43(34(37)59)64-24-10-8-23(9-11-24)40(62)50-17-7-16-49-15-6-5-14-48-13-4-3-12-45/h8-11,21-22,25-38,41-44,48-49,52-60H,3-7,12-20,45-47H2,1-2H3,(H,50,62)(H,51,61)
Synonyms:- glysperin C
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glysperin C
CAS:Glysperin C exhibits activity against both Gram-positive and Gram-negative bacteria, including strains resistant to aminoglycoside antibiotics.Formula:C44H77N7O19Color and Shape:SolidMolecular weight:1008.12
