CymitQuimica logo

CAS 78213-55-5

:

glysperin B

Description:
Glysperin B, identified by its CAS number 78213-55-5, is a chemical compound that belongs to the class of glycosides. It is characterized by its structure, which typically includes a sugar moiety linked to a non-sugar component, often contributing to its biological activity. Glysperin B is known for its potential applications in various fields, including pharmaceuticals and cosmetics, due to its properties that may exhibit antioxidant and anti-inflammatory effects. The compound is soluble in water, which enhances its utility in formulations. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many glycosides, glysperin B may also demonstrate specific interactions with biological systems, making it of interest for further research in medicinal chemistry. However, detailed studies on its pharmacokinetics, toxicity, and specific mechanisms of action are essential for a comprehensive understanding of its potential uses and safety profile.
Formula:C40H66N6O18
InChI:InChI=1/C40H66N6O18/c1-17(42)35(55)46-25-27(50)24(43)18(2)57-37(25)62-32-22(15-47)60-38(29(52)28(32)51)64-34-26(49)19(3)58-39(31(34)54)63-33-23(16-48)61-40(30(33)53)59-21-9-7-20(8-10-21)36(56)45-14-6-13-44-12-5-4-11-41/h7-10,17-18,22-34,37-40,44,47-54H,3-6,11-16,41-43H2,1-2H3,(H,45,56)(H,46,55)
Synonyms:
  • glysperin B
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Glysperin B

    CAS:
    Glysperin B exhibits activity against both Gram-positive and Gram-negative bacteria, including those resistant to aminoglycoside antibiotics.
    Formula:C40H66N6O18
    Color and Shape:Solid
    Molecular weight:918.981

    Ref: TM-TN10189

    10mg
    To inquire
    50mg
    To inquire