CAS 78213-56-6
:glysperin A
Description:
Glysperin A, with the CAS number 78213-56-6, is a chemical compound that belongs to the class of glycerol derivatives. It is characterized by its unique molecular structure, which includes a glycerol backbone modified with specific functional groups that contribute to its biological activity. Glysperin A is often studied for its potential applications in pharmaceuticals and biotechnology, particularly due to its properties that may influence cellular processes. The compound is typically soluble in water and exhibits stability under various conditions, making it suitable for various formulations. Its biological activity may include antioxidant properties, which can be beneficial in protecting cells from oxidative stress. Additionally, Glysperin A may interact with specific biological targets, leading to potential therapeutic effects. As with many chemical substances, safety and handling precautions are essential when working with Glysperin A, and it is important to refer to safety data sheets for detailed information on its properties and hazards.
Formula:C44H75N7O18
InChI:InChI=1/C44H75N7O18/c1-21(46)39(60)51-29-31(55)28(47)22(2)62-41(29)67-36-26(19-52)65-42(33(57)32(36)56)69-38-30(54)23(3)63-43(35(38)59)68-37-27(20-53)66-44(34(37)58)64-25-11-9-24(10-12-25)40(61)50-18-8-17-49-16-7-6-15-48-14-5-4-13-45/h9-12,21-22,26-38,41-44,48-49,52-59H,3-8,13-20,45-47H2,1-2H3,(H,50,61)(H,51,60)
Synonyms:- glysperin A
- Benzamide, 4-[[O-4-amino-2-[[(2S)-2-amino-1-oxopropyl]amino]-2,4,6-trideoxy-α-D-galactopyranosyl-(1→4)-O-β-D-galactopyranosyl-(1→3)-O-6-deoxy-α-D-xylo-hex-5-enopyranosyl-(1→3)-α-D-ribofuranosyl]oxy]-N-[3-[[4-[(4-aminobutyl)amino]butyl]amino]propyl]- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glysperin A
CAS:Glysperin A exhibits activity against both Gram-positive and Gram-negative bacteria, including strains resistant to aminoglycoside antibiotics.Formula:C44H75N7O18Color and Shape:SolidMolecular weight:990.102
