
CAS 78213-69-1
:4,6-Pyrimidinedicarboxaldehyde
Description:
4,6-Pyrimidinedicarboxaldehyde is an organic compound characterized by its pyrimidine ring structure, which features two aldehyde functional groups at the 4 and 6 positions. This compound is typically a white to light yellow crystalline solid, exhibiting a relatively high melting point. It is soluble in polar solvents such as water and alcohols, which facilitates its use in various chemical reactions. The presence of two aldehyde groups makes it a versatile intermediate in organic synthesis, allowing for the formation of various derivatives through reactions such as condensation and oxidation. Additionally, 4,6-Pyrimidinedicarboxaldehyde can participate in nucleophilic addition reactions, making it useful in the synthesis of heterocyclic compounds and pharmaceuticals. Its reactivity and structural features also make it a candidate for applications in materials science and biochemistry. Safety precautions should be taken when handling this compound, as with many aldehydes, due to potential irritant properties and reactivity.
Formula:C6H4N2O2
InChI:InChI=1S/C6H4N2O2/c9-2-5-1-6(3-10)8-4-7-5/h1-4H
InChI key:InChIKey=PGWZFOMWBKJPRP-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=O)N=CN1
Synonyms:- 4,6-Pyrimidinedicarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.