CAS 78222-09-0

1,3,7-triazaspiro[4.5]decane-2,4-dione

Description:

1,3,7-Triazaspiro[4.5]decane-2,4-dione, with the CAS number 78222-09-0, is a heterocyclic organic compound characterized by its unique spirocyclic structure, which incorporates three nitrogen atoms within a bicyclic framework. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in various chemical reactions. The presence of nitrogen atoms in the ring structure can impart basicity and influence the compound's interaction with other chemical species. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the spiro structure can lead to interesting conformational properties, affecting the compound's stability and solubility. Overall, 1,3,7-triazaspiro[4.5]decane-2,4-dione represents a class of compounds that can be explored for their synthetic utility and potential applications in pharmaceuticals and materials science.

Formula: C₇H₁₁N₃O₂

InChI: InChI=1/C7H11N3O2/c11-5-7(10-6(12)9-5)2-1-3-8-4-7/h8H,1-4H2,(H2,9,10,11,12)

SMILES: C1CC2(CNC1)C(=NC(=N2)O)O

1,3,7-Triazaspiro[4.5]decane-2,4-dione

CAS: 78222-09-0

Formula: C₇H₁₁N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 169.1811

Ref: IN-DA008N81

1,3,7-Triaza-spiro[4.5]decane-2,4-dione

CAS: 78222-09-0

1,3,7-Triaza-spiro[4.5]decane-2,4-dione

Purity: 97%

Molecular weight: 169.18g/mol

Ref: 54-OR323145

1,3,7-TRIAZA-SPIRO[4.5]DECANE-2,4-DIONE

CAS: 78222-09-0

Formula: C₇H₁₁N₃O₂

Purity: 97%

Molecular weight: 169.184

Ref: 10-F501842

1,3,7-Triaza-spiro[4.5]decane-2,4-dione

CAS: 78222-09-0

Benzodioxane is a benzodioxan derivative that is used in pharmaceutical preparations. It has been used as a cationic surfactant, ethylene polymerization catalyst, and hydrogen peroxide initiator. Benzodioxane is also an electrophotographic developer, glycol ether solvent, and fatty acid ester solubilizer. It can be used as a component of polyvinyl pyrrolidone (PVP) to produce a water-soluble polymer. Benzodioxane has also been shown to have anti-inflammatory properties due to its ability to inhibit the formation of prostaglandin E2 from arachidonic acid.

Formula: C₇H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 169.18 g/mol

Ref: 3D-DDA22209