CAS 78225-99-7

Perfluoroheptanoic acid anhydride

Description:

Perfluoroheptanoic acid anhydride, with the CAS number 78225-99-7, is a fluorinated organic compound characterized by its perfluorinated carbon chain, which imparts unique properties such as high thermal stability, chemical resistance, and low surface energy. This compound is derived from perfluoroheptanoic acid and exists as an anhydride, meaning it is formed by the removal of water from the acid, resulting in a structure that can facilitate reactions with nucleophiles. Perfluoroheptanoic acid anhydride is typically colorless to pale yellow and may exhibit a waxy texture. Its fluorinated nature makes it hydrophobic and oleophobic, making it useful in various applications, including surface treatments and coatings that require water and oil repellency. However, it is important to note that perfluoroalkyl substances (PFAS), including this compound, have raised environmental and health concerns due to their persistence in the environment and potential bioaccumulation. Therefore, handling and disposal of this substance must adhere to regulatory guidelines to mitigate any adverse effects.

Formula: C₁₄F₂₆O₃

InChI: InChI=1/C14F26O3/c15-3(16,5(19,20)7(23,24)9(27,28)11(31,32)13(35,36)37)1(41)43-2(42)4(17,18)6(21,22)8(25,26)10(29,30)12(33,34)14(38,39)40

SMILES: C(=O)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)OC(=O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Synonyms:

• Perfluoroheptanoic anhydride
• Tridecafluoroheptanoic Anhydride

Perfluoroheptanoic anhydride

CAS: 78225-99-7

Perfluoroheptanoic anhydride

Formula: C₁₄F₂₆O₃

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 710.11g/mol

Ref: 54-PC9291