CAS 78235-72-0
:ethyl {4-[3-(aminomethyl)-4-hydroxybenzoyl]-2,3-dichlorophenoxy}acetate
Description:
Ethyl {4-[3-(aminomethyl)-4-hydroxybenzoyl]-2,3-dichlorophenoxy}acetate, with the CAS number 78235-72-0, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a dichlorophenoxy moiety. This compound features a benzoyl group that is substituted with an aminomethyl and a hydroxy group, contributing to its potential biological activity. The presence of chlorine atoms in the dichlorophenoxy segment enhances its lipophilicity and may influence its interaction with biological systems. Ethyl esters are generally known for their volatility and solubility in organic solvents, which can affect their application in various fields, including pharmaceuticals and agrochemicals. The specific functional groups present in this compound suggest potential uses in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies on its toxicity, stability, and reactivity would be necessary to fully understand its characteristics and potential applications.
Formula:C18H17Cl2NO5
InChI:InChI=1/C18H17Cl2NO5/c1-2-25-15(23)9-26-14-6-4-12(16(19)17(14)20)18(24)10-3-5-13(22)11(7-10)8-21/h3-7,22H,2,8-9,21H2,1H3
Synonyms:- Ethyl {4-[3-(aminomethyl)-4-hydroxybenzoyl]-2,3-dichlorophenoxy}acetate
- (2,3-Dichloro-4-(3-aminomethyl-4-hydroxybenzoyl)phenoxy)acetic acid ethyl ester
- acetic acid, 2-[4-[3-(aminomethyl)-4-hydroxybenzoyl]-2,3-dichlorophenoxy]-, ethyl ester
- Acetic acid, (4-(3-(aminomethyl)-4-hydroxybenzoyl)-2,3-dichlorophenoxy)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
A 49816
CAS:A 49816 is a high-ceiling diuretic.Formula:C18H17Cl2NO5Color and Shape:SolidMolecular weight:398.24
