CAS 78238-12-7

3-methoxy-5-nitrobenzoic acid

Description:

3-Methoxy-5-nitrobenzoic acid is an aromatic compound characterized by the presence of both a methoxy group (-OCH3) and a nitro group (-NO2) on a benzoic acid framework. The methoxy group is located at the meta position relative to the carboxylic acid (-COOH) group, while the nitro group is positioned at the para position. This compound typically appears as a solid at room temperature and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and acidity. 3-Methoxy-5-nitrobenzoic acid may be used in various applications, including as an intermediate in organic synthesis and in the development of pharmaceuticals. Its chemical properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other functional groups in a reaction.

Formula: C₈H₇NO₅

InChI: InChI=1/C8H7NO5/c1-14-7-3-5(8(10)11)2-6(4-7)9(12)13/h2-4H,1H3,(H,10,11)

SMILES: COc1cc(cc(c1)N(=O)=O)C(=O)O

Synonyms:

• Benzoic Acid, 3-Methoxy-5-Nitro-

3-Methoxy-5-nitrobenzoic acid

CAS: 78238-12-7

Formula: C₈H₇NO₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.1449

Ref: IN-DA005CH9

5-Methoxy-3-nitrobenzoic acid

CAS: 78238-12-7

5-Methoxy-3-nitrobenzoic acid

Purity: 98%

Molecular weight: 197.14g/mol

Ref: 54-OR345602

3-Methoxy-5-nitrobenzoic acid

CAS: 78238-12-7

3-Methoxy-5-nitrobenzoic acid is an organic compound that has mesomorphic and switchable properties. It is a chalcone derivative, with homologues such as 3-hydroxybenzoic acid. It is synthesized from the reaction of nitrous acid and 3-methoxybenzoic acid. The synthesis of this compound can be achieved by two different routes: peroxide oxidation or fluorine substitution. Both routes produce the same product, but offer different advantages. The first route involves the addition of hydrogen peroxide to 3-methoxybenzoic acid, which produces a mixture of products containing 3-methoxy-5-nitrobenzoic acid. This route is advantageous in that it can be conducted at room temperature with high yields, but the disadvantage is that this method produces a mixture of products which may contain undesired byproducts. The second route involves the use of sodium hypofluorite and potassium

Formula: C₈H₇NO₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 197.14 g/mol

Ref: 3D-FM67871

3-Methoxy-5-nitrobenzoic acid

CAS: 78238-12-7

Formula: C₈H₇NO₅

Purity: 98%

Color and Shape: Solid, Grey powder

Molecular weight: 197.146

Ref: 10-F079590

3-Methoxy-5-nitrobenzoic Acid

CAS: 78238-12-7

Formula: C₈H₇NO₅

Molecular weight: 197.15

Ref: ST-EA-CP-F42107