CAS 78238-14-9
:3-Hydroxy-5-nitrobenzoic acid
Description:
3-Hydroxy-5-nitrobenzoic acid, with the CAS number 78238-14-9, is an aromatic compound characterized by the presence of both hydroxyl (-OH) and nitro (-NO2) functional groups attached to a benzoic acid structure. This compound typically appears as a crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its hydroxyl group. The nitro group contributes to its acidic properties and can influence its reactivity, making it a potential candidate for various chemical reactions, including nitration and esterification. The presence of the hydroxyl group also allows for hydrogen bonding, which can affect its physical properties, such as melting point and boiling point. 3-Hydroxy-5-nitrobenzoic acid may be utilized in organic synthesis, pharmaceuticals, and as a reagent in analytical chemistry. Its specific applications often depend on its reactivity and the functional groups present, making it a versatile compound in chemical research and industry.
Formula:C7H5NO5
InChI:InChI=1/C7H5NO5/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,9H,(H,10,11)
InChI key:InChIKey=ZVLLYIMPDTXFNC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(N(=O)=O)=CC(O)=C1
Synonyms:- 3-Nitro-5-hydroxybenzoic acid
- 5-Hydroxy-3-nitrobenzoic acid
- Benzoic Acid, 3-Hydroxy-5-Nitro-
- 3-Hydroxy-5-nitrobenzoic acid
- 3-Hydroxy-5-nitrobenzoic acid 97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Hydroxy-5-nitrobenzoic acid
CAS:Formula:C7H5NO5Purity:96%Color and Shape:SolidMolecular weight:183.11833-Hydroxy-5-nitrobenzoic acid
CAS:3-Hydroxy-5-nitrobenzoic acidFormula:C7H5NO5Purity:97%Color and Shape: light yellow to yellow solidMolecular weight:183.12g/mol3-Hydroxy-5-nitrobenzoic acid
CAS:3-Hydroxy-5-nitrobenzoic acid is a reactive mesomorphic compound. It is often used as an analytical reagent and has been shown to be useful in spectrometric analysis of amino acid sequences. 3-Hydroxy-5-nitrobenzoic acid can be quantified by gas chromatography and mass spectrometry to determine its chemical composition. 3-Hydroxybenzoic acid and 2,5-dihydroxybenzoic acid are the two main products that are formed when this compound reacts with hydroxyl radical under certain conditions.
Formula:C7H5NO5Purity:Min. 98%Color and Shape:PowderMolecular weight:183.12 g/mol3-Hydroxy-5-nitrobenzoic acid
CAS:Formula:C7H5NO5Purity:98%Color and Shape:SolidMolecular weight:183.1193-Hydroxy-5-nitrobenzoic acid
CAS:Controlled ProductStability Hygroscopic
Applications 3-Hydroxy-5-nitrobenzoic acidFormula:C7H5NO5Color and Shape:NeatMolecular weight:183.12





