CAS 78239-66-4
:3-Bromo-4-fluorobenzoyl bromide
Description:
3-Bromo-4-fluorobenzoyl bromide is an organic compound characterized by its aromatic structure, which includes a benzoyl group substituted with both bromine and fluorine atoms. The presence of these halogens contributes to its reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its ability to participate in electrophilic aromatic substitution reactions due to the electron-withdrawing effects of the bromine and fluorine substituents. Its molecular structure includes a carbonyl group, which enhances its reactivity, making it a useful intermediate in organic synthesis. Additionally, 3-Bromo-4-fluorobenzoyl bromide may exhibit specific physical properties such as melting point, boiling point, and solubility that are influenced by its halogen substituents. As with many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C7H3Br2FO
InChI:InChI=1/C7H3Br2FO/c8-5-3-4(7(9)11)1-2-6(5)10/h1-3H
InChI key:InChIKey=MADVJOUJBMNYJF-UHFFFAOYSA-N
SMILES:C(Br)(=O)C1=CC(Br)=C(F)C=C1
Synonyms:- 3-Bromo-4-fluorobenzoyl bromide
- Benzoyl bromide, 3-bromo-4-fluoro-
- 3-Bromo-4-fluorobenzoic acid bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
