CAS 782414-84-0

2-(2-methyl-1H-imidazol-1-yl)propanoic acid

Description:

2-(2-methyl-1H-imidazol-1-yl)propanoic acid, with the CAS number 782414-84-0, is an organic compound characterized by its imidazole ring and carboxylic acid functional group. This substance features a propanoic acid backbone, which contributes to its acidic properties. The presence of the 2-methyl-1H-imidazole moiety imparts unique biological and chemical properties, making it of interest in various fields, including pharmaceuticals and biochemistry. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the imidazole ring may participate in hydrogen bonding and coordination with metal ions. Its structural features suggest potential applications in drug development, particularly in the design of compounds that target specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, 2-(2-methyl-1H-imidazol-1-yl)propanoic acid represents a versatile chemical entity with potential utility in various scientific domains.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1/C7H10N2O2/c1-5(7(10)11)9-4-3-8-6(9)2/h3-5H,1-2H3,(H,10,11)

SMILES: CC(C(=O)O)n1ccnc1C