CAS 78242-22-5
:1H-Pyrazol-4-ol, 1-butyl-
Description:
1H-Pyrazol-4-ol, 1-butyl- (CAS 78242-22-5) is an organic compound characterized by its pyrazole ring structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits properties associated with both pyrazole derivatives and alcohols, including potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The butyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. 1H-Pyrazol-4-ol derivatives are often studied for their biological activities, including potential applications in pharmaceuticals and agrochemicals. The compound may exhibit antioxidant, anti-inflammatory, or antimicrobial properties, making it of interest in medicinal chemistry. Additionally, its stability and reactivity can be influenced by the substituents on the pyrazole ring, which can affect its interaction with other chemical species. Overall, 1H-Pyrazol-4-ol, 1-butyl- is a versatile compound with potential applications in various fields, including drug development and materials science.
Formula:C7H12N2O
InChI:InChI=1S/C7H12N2O/c1-2-3-4-9-6-7(10)5-8-9/h5-6,10H,2-4H2,1H3
InChI key:InChIKey=WUKPKOYUFRYXNT-UHFFFAOYSA-N
SMILES:C(CCC)N1C=C(O)C=N1
Synonyms:- 1-Butyl-1H-pyrazol-4-ol
- 1H-Pyrazol-4-ol, 1-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.