CAS 78242-24-7
:1-(1,1-Dimethylethyl)-1H-pyrazol-4-ol
Description:
1-(1,1-Dimethylethyl)-1H-pyrazol-4-ol, with the CAS number 78242-24-7, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a tert-butyl group (1,1-dimethylethyl) attached to the pyrazole, contributing to its hydrophobic properties. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the hydroxyl (-OH) group at the 4-position of the pyrazole ring enhances its reactivity and solubility in polar solvents. Additionally, this compound may exhibit biological activity, making it of interest for research in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, 1-(1,1-Dimethylethyl)-1H-pyrazol-4-ol is a versatile compound with significant potential in chemical research and industry.
Formula:C7H12N2O
InChI:InChI=1S/C7H12N2O/c1-7(2,3)9-5-6(10)4-8-9/h4-5,10H,1-3H3
InChI key:InChIKey=QIOZBOIKXWYBTL-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1C=C(O)C=N1
Synonyms:- 1H-Pyrazol-4-ol, 1-(1,1-dimethylethyl)-
- 1-tert-Butyl-1H-pyrazol-4-ol
- 1-(1,1-Dimethylethyl)-1H-pyrazol-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.