
CAS 78243-63-7
:3,5-Dimethylthiomorpholine
Description:
3,5-Dimethylthiomorpholine is a heterocyclic organic compound characterized by a morpholine ring with two methyl groups attached at the 3 and 5 positions and a sulfur atom in the ring. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in water and organic solvents, which makes it versatile for various applications. The presence of the sulfur atom contributes to its unique chemical properties, including potential reactivity in nucleophilic substitution reactions. 3,5-Dimethylthiomorpholine is often used as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its structure allows for the formation of various derivatives, enhancing its utility in chemical research. Safety data indicates that, like many thiol-containing compounds, it should be handled with care due to potential irritant properties. Overall, 3,5-Dimethylthiomorpholine is an important compound in synthetic organic chemistry with applications in multiple fields.
Formula:C6H13NS
InChI:InChI=1S/C6H13NS/c1-5-3-8-4-6(2)7-5/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=BFJTWSMISPCLAO-UHFFFAOYSA-N
SMILES:CC1NC(C)CSC1
Synonyms:- 3,5-Dimethylthiomorpholine
- Thiomorpholine, 3,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.