CAS 78243-68-2

5-Amino-2-(4-methyl-1-piperidinyl)benzoic acid

Description:

5-Amino-2-(4-methyl-1-piperidinyl)benzoic acid, with the CAS number 78243-68-2, is an organic compound characterized by its amino and carboxylic acid functional groups, which contribute to its properties as an amino acid derivative. This compound features a benzoic acid core substituted with an amino group at the 5-position and a piperidine ring with a methyl group at the 4-position. The presence of the piperidine moiety enhances its potential for biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and is soluble in polar solvents due to its functional groups. Its structure suggests potential interactions with biological targets, which may include enzyme inhibition or receptor binding. The compound's properties, such as melting point, solubility, and reactivity, can vary based on environmental conditions and the presence of other substances. Overall, 5-Amino-2-(4-methyl-1-piperidinyl)benzoic acid is a significant compound in research, particularly in the fields of pharmaceuticals and biochemistry.

Formula: C₁₃H₁₈N₂O₂

InChI: InChI=1S/C13H18N2O2/c1-9-4-6-15(7-5-9)12-3-2-10(14)8-11(12)13(16)17/h2-3,8-9H,4-7,14H2,1H3,(H,16,17)

InChI key: InChIKey=WLIBXILRXKJRAY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(N)=C1)N2CCC(C)CC2

Synonyms:

• 5-Amino-2-(4-methyl-1-piperidinyl)benzoic acid
• Benzoic acid, 5-amino-2-(4-methyl-1-piperidinyl)-