CymitQuimica logo

CAS 782479-89-4

:

2-(1-Methylethoxy)-3-(trimethylsilyl)pyridine

Description:
2-(1-Methylethoxy)-3-(trimethylsilyl)pyridine, identified by its CAS number 782479-89-4, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a trimethylsilyl group, which enhances its stability and solubility in organic solvents, making it useful in various chemical reactions, particularly in synthetic organic chemistry. The presence of the 1-methylethoxy group contributes to its unique reactivity and potential applications in catalysis and as a ligand in coordination chemistry. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure allows for interactions with other chemical species, making it valuable in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly. Overall, its distinctive functional groups and structural features make it a compound of interest in both academic and industrial research settings.
Formula:C11H19NOSi
InChI:InChI=1S/C11H19NOSi/c1-9(2)13-11-10(14(3,4)5)7-6-8-12-11/h6-9H,1-5H3
InChI key:InChIKey=NARJMUQSDREMTB-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=C(OC(C)C)N=CC=C1
Synonyms:
  • Pyridine, 2-(1-methylethoxy)-3-(trimethylsilyl)-
  • 2-(1-Methylethoxy)-3-(trimethylsilyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.