CAS 782479-90-7

2-(Cyclopropylmethoxy)-3-(trimethylsilyl)pyridine

Description:

2-(Cyclopropylmethoxy)-3-(trimethylsilyl)pyridine, identified by its CAS number 782479-90-7, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a cyclopropylmethoxy group, which contributes to its unique reactivity and solubility properties, as well as a trimethylsilyl group that enhances its stability and influences its interaction with other chemical species. The presence of these substituents can affect the compound's polarity, making it useful in various chemical reactions, including those in synthetic organic chemistry. Additionally, the trimethylsilyl group can serve as a protecting group for functional groups during chemical transformations. The compound's structure suggests potential applications in medicinal chemistry and materials science, where modifications to the pyridine ring can lead to diverse biological activities or functional properties. Overall, the unique combination of functional groups in this compound provides a versatile platform for further chemical exploration and application.

Formula: C₁₂H₁₉NOSi

InChI: InChI=1S/C12H19NOSi/c1-15(2,3)11-5-4-8-13-12(11)14-9-10-6-7-10/h4-5,8,10H,6-7,9H2,1-3H3

InChI key: InChIKey=SWMZBIJARDLLKV-UHFFFAOYSA-N

SMILES: [Si](C)(C)(C)C1=C(OCC2CC2)N=CC=C1

Synonyms:

• Pyridine, 2-(cyclopropylmethoxy)-3-(trimethylsilyl)-
• 2-(Cyclopropylmethoxy)-3-(trimethylsilyl)pyridine

2-Cyclopropylmethoxy-3-trimethylsilanyl-pyridine

CAS: 782479-90-7

Formula: C₁₂H₁₉NOSi

Molecular weight: 221.3709

Ref: IN-DA003H53