CAS 782494-04-6

α-Methyl-4-piperidinepropanoic acid

Description:

α-Methyl-4-piperidinepropanoic acid, identified by its CAS number 782494-04-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a propanoic acid moiety, contributing to its acidic properties. The presence of the α-methyl group enhances its steric bulk, which can influence its biological activity and interactions. Typically, compounds like this may exhibit properties such as solubility in polar solvents due to the carboxylic acid functional group, while the piperidine ring can provide basic characteristics. α-Methyl-4-piperidinepropanoic acid is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with various biological targets. Its structural features suggest potential applications in neuropharmacology or as a building block in the synthesis of more complex molecules. However, specific data regarding its reactivity, stability, and safety profile would require further investigation through experimental studies and literature review.

Formula: C₉H₁₇NO₂

InChI: InChI=1S/C9H17NO2/c1-7(9(11)12)6-8-2-4-10-5-3-8/h7-8,10H,2-6H2,1H3,(H,11,12)

InChI key: InChIKey=MVFMEHOBPSVMRI-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)C)C1CCNCC1

Synonyms:

• α-Methyl-4-piperidinepropanoic acid
• 4-Piperidinepropanoic acid, α-methyl-
• 2-Methyl-3-(piperidin-4-yl)propanoic acid