CymitQuimica logo

CAS 782504-62-5

:

4-[3-methoxy-5-(trifluoromethyl)benzyl]piperidinium chloride

Description:
4-[3-Methoxy-5-(trifluoromethyl)benzyl]piperidinium chloride is a quaternary ammonium compound characterized by its piperidine core, which is substituted with a benzyl group that features a methoxy and a trifluoromethyl group. This structure imparts unique properties, including potential lipophilicity due to the aromatic and trifluoromethyl substituents, which can enhance membrane permeability. The presence of the chloride ion indicates that it is a salt, which can influence its solubility and stability in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its trifluoromethyl group is known to enhance metabolic stability and bioactivity. Additionally, the methoxy group can participate in hydrogen bonding, potentially affecting the compound's interaction with biological targets. Overall, the combination of these functional groups suggests that this compound could have diverse applications in drug design and development, although specific biological activities would require further investigation.
Formula:C14H19ClF3NO
InChI:InChI=1/C14H18F3NO.ClH/c1-19-13-8-11(6-10-2-4-18-5-3-10)7-12(9-13)14(15,16)17;/h7-10,18H,2-6H2,1H3;1H
SMILES:COc1cc(CC2CCNCC2)cc(c1)C(F)(F)F.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.