CAS 782504-66-9

2-[3-(trifluoromethyl)benzyl]piperidinium chloride

Description:

2-[3-(Trifluoromethyl)benzyl]piperidinium chloride is a quaternary ammonium compound characterized by its piperidine ring structure, which is substituted with a benzyl group that features a trifluoromethyl group. This compound typically exhibits properties common to quaternary ammonium salts, such as being a white crystalline solid at room temperature and being soluble in polar solvents like water and alcohols. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical applications. Additionally, the chloride ion serves as a counterion, contributing to the compound's stability and solubility. Its unique structure may impart specific reactivity and interaction profiles, making it suitable for various applications in medicinal chemistry, particularly in the development of drugs or as a reagent in organic synthesis. Safety data should be consulted for handling and potential toxicity, as with all chemical substances.

Formula: C₁₃H₁₇ClF₃N

InChI: InChI=1/C13H16F3N.ClH/c14-13(15,16)11-5-3-4-10(8-11)9-12-6-1-2-7-17-12;/h3-5,8,12,17H,1-2,6-7,9H2;1H

SMILES: C1CCNC(C1)Cc1cccc(c1)C(F)(F)F.Cl

Synonyms:

• 2-[3-(Trifluoromethyl)benzyl]piperidine hydrochloride (1:1)

2-(3-Trifluoromethyl-benzyl)-piperidine hydrochloride

CAS: 782504-66-9

2-(3-Trifluoromethyl-benzyl)-piperidine hydrochloride

Purity: 95%

Molecular weight: 279.73g/mol

Ref: 54-PC404535

2-(3-Trifluoromethyl-Benzyl)-Piperidine Hydrochloride

Controlled Product

CAS: 782504-66-9

Please enquire for more information about 2-(3-Trifluoromethyl-Benzyl)-Piperidine Hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₇ClF₃N

Purity: Min. 95%

Molecular weight: 279.73 g/mol

Ref: 3D-FT93624