CAS 782504-72-7

4-(3-hydroxybenzyl)piperidinium chloride

Description:

4-(3-Hydroxybenzyl)piperidinium chloride is a quaternary ammonium compound characterized by its piperidine ring structure substituted with a 3-hydroxybenzyl group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the quaternary ammonium group, which enhances its ionic character. The hydroxyl group on the benzyl moiety can participate in hydrogen bonding, potentially influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its chloride salt form indicates that it is a stable ionic compound, which can facilitate its use in various applications, including as a potential drug candidate or in biochemical research. Safety data should be consulted for handling and usage, as quaternary ammonium compounds can have specific toxicity profiles. Overall, 4-(3-hydroxybenzyl)piperidinium chloride is notable for its structural features and potential applications in scientific research.

Formula: C₁₂H₁₈ClNO

InChI: InChI=1/C12H17NO.ClH/c14-12-3-1-2-11(9-12)8-10-4-6-13-7-5-10;/h1-3,9-10,13-14H,4-8H2;1H

SMILES: c1cc(CC2CCNCC2)cc(c1)O.Cl

Synonyms:

• 3-(Piperidin-4-ylmethyl)phenol hydrochloride (1:1)
• Phenol, 3-(4-Piperidinylmethyl)-, Hydrochloride (1:1)

3-Piperidin-4-ylmethyl-phenol hydrochloride

CAS: 782504-72-7

3-Piperidin-4-ylmethyl-phenol hydrochloride

Purity: ≥95%

Molecular weight: 227.73g/mol

Ref: 54-OR307721