CAS 78259-41-3
:Foeniculin
Description:
Foeniculin, with the CAS number 78259-41-3, is a chemical compound that is primarily derived from the seeds of the fennel plant (Foeniculum vulgare). It is classified as a natural product and is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. Foeniculin is characterized by its unique molecular structure, which includes specific functional groups that contribute to its reactivity and interaction with biological systems. The compound is often studied for its pharmacological potential, particularly in traditional medicine contexts. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in various formulations. Additionally, research into Foeniculin may explore its mechanisms of action, efficacy, and safety profile, making it a subject of interest in both organic chemistry and pharmacology. Overall, Foeniculin represents a fascinating area of study within the realm of natural products and their applications in health and medicine.
Formula:C14H18O
InChI:InChI=1S/C14H18O/c1-4-5-13-6-8-14(9-7-13)15-11-10-12(2)3/h4-10H,11H2,1-3H3/b5-4+
InChI key:InChIKey=JGELFJUQMIUNOO-SNAWJCMRSA-N
SMILES:O(CC=C(C)C)C1=CC=C(/C=C/C)C=C1
Synonyms:- Benzene, 1-[(3-methyl-2-butenyl)oxy]-4-(1E)-1-propenyl-
- Foeniculin (ether)
- Benzene, 1-[(3-methyl-2-buten-1-yl)oxy]-4-(1E)-1-propen-1-yl-
- 1-[(3-Methyl-2-buten-1-yl)oxy]-4-(1E)-1-propen-1-ylbenzene
- Benzene, 1-[(3-methyl-2-butenyl)oxy]-4-(1-propenyl)-, (E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Foeniculin
CAS:Aromatic ethers and their halogenated, sulfonated, nitrated or nitrosated derivativesFormula:C14H18OColor and Shape:LiquidMolecular weight:202.29Foeniculin
CAS:Controlled ProductApplications Foeniculin is a compound within Illicium verum essential oil, which is also known as Star Anise.
References Zhang, Guangjie. et al., Molecules. 23, 1126/1-1126/15(2018);Formula:C14H18OColor and Shape:NeatMolecular weight:202.29Foeniculin
CAS:Foeniculin is a bioactive compound found in the seeds of the plant Foeniculum vulgare, commonly known as fennel. This naturally occurring compound is a phenylpropanoid belonging to the family of essential oil constituents. Foeniculin exerts its effects primarily through interactions with various biological pathways, including modulation of enzyme activity and potential anti-inflammatory properties. These mechanisms are of particular interest due to their implications for therapeutic applications.Formula:C14H18OPurity:Min. 95%Color and Shape:PowderMolecular weight:202.29 g/mol


