CAS 78259-50-4
:Gibb-3-ene-1,10-dicarboxylic acid, 4a,7-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1α,4aα,4bβ,10β)-
Description:
Gibb-3-ene-1,10-dicarboxylic acid, 4a,7-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, with the CAS number 78259-50-4, is a complex organic compound characterized by its unique bicyclic structure and multiple functional groups. This substance features a lactone ring, which is a cyclic ester formed from the reaction of a hydroxyl group and a carboxylic acid. The presence of two carboxylic acid groups contributes to its acidity and potential reactivity in various chemical environments. Additionally, the hydroxyl groups provide sites for hydrogen bonding, influencing its solubility and interaction with other molecules. The methyl and methylene groups in the structure contribute to its hydrophobic characteristics, which can affect its biological activity and stability. Gibb-3-ene derivatives are often studied for their potential applications in pharmaceuticals and agrochemicals due to their structural complexity and biological activity. Understanding the properties of such compounds is crucial for their application in various fields, including medicinal chemistry and biochemistry.
Formula:C19H22O5
InChI:InChI=1S/C19H22O5/c1-10-8-17-9-18(10,23)7-4-11(17)19-6-3-5-16(2,15(22)24-19)13(19)12(17)14(20)21/h3,6,11-13,23H,1,4-5,7-9H2,2H3,(H,20,21)/t11-,12-,13-,16-,17+,18+,19-/m1/s1
InChI key:InChIKey=UXLXLQYIDWLPKX-KQBHUUJHSA-N
SMILES:C(O)(=O)[C@@H]1[C@]23[C@]([C@]45[C@]1([C@](C)(C(=O)O4)CC=C5)[H])(CC[C@](O)(C2)C(=C)C3)[H]
Synonyms:- 4a,1-(Epoxymethano)-7,9a-methanobenz[a]azulene, gibb-3-ene-1,10-dicarboxylic acid deriv.
- GA95
- Gibberellin A95
- Gibberellin GA95
- Gibb-3-ene-1,10-dicarboxylic acid, 4a,7-dihydroxy-1-methyl-8-methylene-, 1,4a-lactone, (1α,4aα,4bβ,10β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
